C24H23N3O — CID 135461865
[(4S,5S)-2-ethylimino-4,5-diphenylimidazolidin-1-yl]-phenylmethanone (PubChem CID 135461865) has the molecular formula C24H23N3O and a molecular weight of 369.47 g/mol. Its IUPAC name is [(4S,5S)-2-ethylimino-4,5-diphenylimidazolidin-1-yl]-phenylmethanone.
| Compound Name | [(4S,5S)-2-ethylimino-4,5-diphenylimidazolidin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 135461865 |
| Molecular Formula | C24H23N3O |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | [(4S,5S)-2-ethylimino-4,5-diphenylimidazolidin-1-yl]-phenylmethanone |
| SMILES | CC/N=C1\N[C@@H](c2ccccc2)[C@H](c2ccccc2)N1C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H23N3O/c1-2-25-24-26-21(18-12-6-3-7-13-18)22(19-14-8-4-9-15-19)27(24)23(28)20-16-10-5-11-17-20/h3-17,21-22H,2H2,1H3,(H,25,26)/t21-,22-/m0/s1 |
| InChIKey | VNUUNTMHRPMESD-VXKWHMMOSA-N |
| XLogP | 4.59 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|