C18H17NO — CID 11587010
(2-ethyl-3-methylidene-2H-indol-1-yl)-phenylmethanone (PubChem CID 11587010) has the molecular formula C18H17NO and a molecular weight of 263.34 g/mol. Its IUPAC name is (2-ethyl-3-methylidene-2H-indol-1-yl)-phenylmethanone.
| Compound Name | (2-ethyl-3-methylidene-2H-indol-1-yl)-phenylmethanone |
|---|---|
| PubChem CID | 11587010 |
| Molecular Formula | C18H17NO |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | (2-ethyl-3-methylidene-2H-indol-1-yl)-phenylmethanone |
| SMILES | C=C1c2ccccc2N(C(=O)c2ccccc2)C1CC |
| InChI | InChI=1S/C18H17NO/c1-3-16-13(2)15-11-7-8-12-17(15)19(16)18(20)14-9-5-4-6-10-14/h4-12,16H,2-3H2,1H3 |
| InChIKey | KKMBGSURGSTNJR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |