C27H31NO3 — CID 142989768
ethane;2-methyl-1-(4-phenoxybenzoyl)-2,3-dihydroquinolin-4-one (PubChem CID 142989768) has the molecular formula C27H31NO3 and a molecular weight of 417.55 g/mol. Its IUPAC name is ethane;2-methyl-1-(4-phenoxybenzoyl)-2,3-dihydroquinolin-4-one.
| Compound Name | ethane;2-methyl-1-(4-phenoxybenzoyl)-2,3-dihydroquinolin-4-one |
|---|---|
| PubChem CID | 142989768 |
| Molecular Formula | C27H31NO3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | ethane;2-methyl-1-(4-phenoxybenzoyl)-2,3-dihydroquinolin-4-one |
| SMILES | CC.CC.CC1CC(=O)c2ccccc2N1C(=O)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C23H19NO3.2C2H6/c1-16-15-22(25)20-9-5-6-10-21(20)24(16)23(26)17-11-13-19(14-12-17)27-18-7-3-2-4-8-18;2*1-2/h2-14,16H,15H2,1H3;2*1-2H3 |
| InChIKey | UKMPHEXKNFASHV-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |