C24H23NO2S — CID 28578257
[(2R)-2-methyl-2,3-dihydroindol-1-yl]-[4-(2-phenylsulfanylethoxy)phenyl]methanone (PubChem CID 28578257) has the molecular formula C24H23NO2S and a molecular weight of 389.52 g/mol. Its IUPAC name is [(2R)-2-methyl-2,3-dihydroindol-1-yl]-[4-(2-phenylsulfanylethoxy)phenyl]methanone.
| Compound Name | [(2R)-2-methyl-2,3-dihydroindol-1-yl]-[4-(2-phenylsulfanylethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 28578257 |
| Molecular Formula | C24H23NO2S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | [(2R)-2-methyl-2,3-dihydroindol-1-yl]-[4-(2-phenylsulfanylethoxy)phenyl]methanone |
| SMILES | C[C@@H]1Cc2ccccc2N1C(=O)c1ccc(OCCSc2ccccc2)cc1 |
| InChI | InChI=1S/C24H23NO2S/c1-18-17-20-7-5-6-10-23(20)25(18)24(26)19-11-13-21(14-12-19)27-15-16-28-22-8-3-2-4-9-22/h2-14,18H,15-17H2,1H3/t18-/m1/s1 |
| InChIKey | NMGVOSFCQZPXEF-GOSISDBHSA-N |
| XLogP | 5.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|