C27H30N2O2S — CID 28633427
[4-(2,3-dimethylphenyl)piperazin-1-yl]-[4-(2-phenylsulfanylethoxy)phenyl]methanone (PubChem CID 28633427) has the molecular formula C27H30N2O2S and a molecular weight of 446.62 g/mol. Its IUPAC name is [4-(2,3-dimethylphenyl)piperazin-1-yl]-[4-(2-phenylsulfanylethoxy)phenyl]methanone.
| Compound Name | [4-(2,3-dimethylphenyl)piperazin-1-yl]-[4-(2-phenylsulfanylethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 28633427 |
| Molecular Formula | C27H30N2O2S |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | [4-(2,3-dimethylphenyl)piperazin-1-yl]-[4-(2-phenylsulfanylethoxy)phenyl]methanone |
| SMILES | Cc1cccc(N2CCN(C(=O)c3ccc(OCCSc4ccccc4)cc3)CC2)c1C |
| InChI | InChI=1S/C27H30N2O2S/c1-21-7-6-10-26(22(21)2)28-15-17-29(18-16-28)27(30)23-11-13-24(14-12-23)31-19-20-32-25-8-4-3-5-9-25/h3-14H,15-20H2,1-2H3 |
| InChIKey | LLUVFQULOWESLF-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|