C18H17NO3 — CID 7336980
[4-[(2S)-2-methyl-2,3-dihydroindole-1-carbonyl]phenyl] acetate (PubChem CID 7336980) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is [4-[(2S)-2-methyl-2,3-dihydroindole-1-carbonyl]phenyl] acetate.
| Compound Name | [4-[(2S)-2-methyl-2,3-dihydroindole-1-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 7336980 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | [4-[(2S)-2-methyl-2,3-dihydroindole-1-carbonyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)N2c3ccccc3C[C@@H]2C)cc1 |
| InChI | InChI=1S/C18H17NO3/c1-12-11-15-5-3-4-6-17(15)19(12)18(21)14-7-9-16(10-8-14)22-13(2)20/h3-10,12H,11H2,1-2H3/t12-/m0/s1 |
| InChIKey | TZKDHCCFFCZXON-LBPRGKRZSA-N |
| XLogP | 3.20 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|