C19H19NO4 — CID 57375085
2-(4-benzoyl-2,3-dihydro-1,4-benzoxazin-3-yl)butanoic acid (PubChem CID 57375085) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is 2-(4-benzoyl-2,3-dihydro-1,4-benzoxazin-3-yl)butanoic acid.
| Compound Name | 2-(4-benzoyl-2,3-dihydro-1,4-benzoxazin-3-yl)butanoic acid |
|---|---|
| PubChem CID | 57375085 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 2-(4-benzoyl-2,3-dihydro-1,4-benzoxazin-3-yl)butanoic acid |
| SMILES | CCC(C(=O)O)C1COc2ccccc2N1C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H19NO4/c1-2-14(19(22)23)16-12-24-17-11-7-6-10-15(17)20(16)18(21)13-8-4-3-5-9-13/h3-11,14,16H,2,12H2,1H3,(H,22,23) |
| InChIKey | AJSJLZXXJKRVJH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |