C14H17NO3 — CID 10988617
(4S)-3-benzoyl-4-tert-butyl-1,3-oxazolidin-2-one (PubChem CID 10988617) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is (4S)-3-benzoyl-4-tert-butyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-benzoyl-4-tert-butyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10988617 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | (4S)-3-benzoyl-4-tert-butyl-1,3-oxazolidin-2-one |
| SMILES | CC(C)(C)[C@H]1COC(=O)N1C(=O)c1ccccc1 |
| InChI | InChI=1S/C14H17NO3/c1-14(2,3)11-9-18-13(17)15(11)12(16)10-7-5-4-6-8-10/h4-8,11H,9H2,1-3H3/t11-/m1/s1 |
| InChIKey | KMMCOPLPYZODGU-LLVKDONJSA-N |
| XLogP | 2.69 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |