C23H27NO2 — CID 101342379
(4S)-4-tert-butyl-3-[(Z)-2,3-diphenylbut-1-enyl]-1,3-oxazolidin-2-one (PubChem CID 101342379) has the molecular formula C23H27NO2 and a molecular weight of 349.47 g/mol. Its IUPAC name is (4S)-4-tert-butyl-3-[(Z)-2,3-diphenylbut-1-enyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-tert-butyl-3-[(Z)-2,3-diphenylbut-1-enyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 101342379 |
| Molecular Formula | C23H27NO2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | (4S)-4-tert-butyl-3-[(Z)-2,3-diphenylbut-1-enyl]-1,3-oxazolidin-2-one |
| SMILES | CC(/C(=C/N1C(=O)OC[C@@H]1C(C)(C)C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H27NO2/c1-17(18-11-7-5-8-12-18)20(19-13-9-6-10-14-19)15-24-21(23(2,3)4)16-26-22(24)25/h5-15,17,21H,16H2,1-4H3/b20-15-/t17?,21-/m1/s1 |
| InChIKey | MNJJDRDVOJTKOJ-AUYALGGWSA-N |
| XLogP | 5.70 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |