C14H18N2O3 — CID 140849838
N-(4-tert-butyl-2-oxo-1,3-oxazolidin-3-yl)benzamide (PubChem CID 140849838) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is N-(4-tert-butyl-2-oxo-1,3-oxazolidin-3-yl)benzamide.
| Compound Name | N-(4-tert-butyl-2-oxo-1,3-oxazolidin-3-yl)benzamide |
|---|---|
| PubChem CID | 140849838 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-(4-tert-butyl-2-oxo-1,3-oxazolidin-3-yl)benzamide |
| SMILES | CC(C)(C)C1COC(=O)N1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H18N2O3/c1-14(2,3)11-9-19-13(18)16(11)15-12(17)10-7-5-4-6-8-10/h4-8,11H,9H2,1-3H3,(H,15,17) |
| InChIKey | XTBUFKXUSDSKOO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |