C15H18BrNO4 — CID 129098107
(4S)-3-[bromo(2-hydroxypropan-2-yloxy)methyl]-4-(1-phenylethenyl)-1,3-oxazolidin-2-one (PubChem CID 129098107) has the molecular formula C15H18BrNO4 and a molecular weight of 356.22 g/mol. Its IUPAC name is (4S)-3-[bromo(2-hydroxypropan-2-yloxy)methyl]-4-(1-phenylethenyl)-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[bromo(2-hydroxypropan-2-yloxy)methyl]-4-(1-phenylethenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 129098107 |
| Molecular Formula | C15H18BrNO4 |
| Molecular Weight | 356.22 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | (4S)-3-[bromo(2-hydroxypropan-2-yloxy)methyl]-4-(1-phenylethenyl)-1,3-oxazolidin-2-one |
| SMILES | C=C(c1ccccc1)[C@H]1COC(=O)N1C(Br)OC(C)(C)O |
| InChI | InChI=1S/C15H18BrNO4/c1-10(11-7-5-4-6-8-11)12-9-20-14(18)17(12)13(16)21-15(2,3)19/h4-8,12-13,19H,1,9H2,2-3H3/t12-,13?/m1/s1 |
| InChIKey | JOZIPSPDQCYLDJ-PZORYLMUSA-N |
| XLogP | 2.94 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.22 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|