C24H22N2OS — CID 102171962
(2R)-1-[(4R,5S)-4,5-diphenyl-2-sulfanylideneimidazolidin-1-yl]-2-phenylpropan-1-one (PubChem CID 102171962) has the molecular formula C24H22N2OS and a molecular weight of 386.52 g/mol. Its IUPAC name is (2R)-1-[(4R,5S)-4,5-diphenyl-2-sulfanylideneimidazolidin-1-yl]-2-phenylpropan-1-one.
| Compound Name | (2R)-1-[(4R,5S)-4,5-diphenyl-2-sulfanylideneimidazolidin-1-yl]-2-phenylpropan-1-one |
|---|---|
| PubChem CID | 102171962 |
| Molecular Formula | C24H22N2OS |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | (2R)-1-[(4R,5S)-4,5-diphenyl-2-sulfanylideneimidazolidin-1-yl]-2-phenylpropan-1-one |
| SMILES | C[C@@H](C(=O)N1C(=S)N[C@H](c2ccccc2)[C@@H]1c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H22N2OS/c1-17(18-11-5-2-6-12-18)23(27)26-22(20-15-9-4-10-16-20)21(25-24(26)28)19-13-7-3-8-14-19/h2-17,21-22H,1H3,(H,25,28)/t17-,21-,22+/m1/s1 |
| InChIKey | TXFYXXAZUBRCBP-YHYVQYDKSA-N |
| XLogP | 4.99 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|