C11H16N2O4S — CID 100936893
[(3aS,7aS)-3-acetyloxy-2-sulfanylidene-3a,4,5,6,7,7a-hexahydrobenzimidazol-1-yl] acetate (PubChem CID 100936893) has the molecular formula C11H16N2O4S and a molecular weight of 272.33 g/mol. Its IUPAC name is [(3aS,7aS)-3-acetyloxy-2-sulfanylidene-3a,4,5,6,7,7a-hexahydrobenzimidazol-1-yl] acetate.
| Compound Name | [(3aS,7aS)-3-acetyloxy-2-sulfanylidene-3a,4,5,6,7,7a-hexahydrobenzimidazol-1-yl] acetate |
|---|---|
| PubChem CID | 100936893 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | [(3aS,7aS)-3-acetyloxy-2-sulfanylidene-3a,4,5,6,7,7a-hexahydrobenzimidazol-1-yl] acetate |
| SMILES | CC(=O)ON1C(=S)N(OC(C)=O)[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C11H16N2O4S/c1-7(14)16-12-9-5-3-4-6-10(9)13(11(12)18)17-8(2)15/h9-10H,3-6H2,1-2H3/t9-,10-/m0/s1 |
| InChIKey | JRRFRSFKTZLASB-UWVGGRQHSA-N |
| XLogP | 1.16 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|