C6H10N2O2S — CID 122591655
(2-sulfanylidene-1,3-diazinan-1-yl) acetate (PubChem CID 122591655) has the molecular formula C6H10N2O2S and a molecular weight of 174.22 g/mol. Its IUPAC name is (2-sulfanylidene-1,3-diazinan-1-yl) acetate.
| Compound Name | (2-sulfanylidene-1,3-diazinan-1-yl) acetate |
|---|---|
| PubChem CID | 122591655 |
| Molecular Formula | C6H10N2O2S |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | (2-sulfanylidene-1,3-diazinan-1-yl) acetate |
| SMILES | CC(=O)ON1CCCNC1=S |
| InChI | InChI=1S/C6H10N2O2S/c1-5(9)10-8-4-2-3-7-6(8)11/h2-4H2,1H3,(H,7,11) |
| InChIKey | HGMAUJBWGDBADZ-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|