C9H14N2O4 — CID 141400367
(2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-3-yl) acetate (PubChem CID 141400367) has the molecular formula C9H14N2O4 and a molecular weight of 214.22 g/mol. Its IUPAC name is (2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-3-yl) acetate.
| Compound Name | (2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-3-yl) acetate |
|---|---|
| PubChem CID | 141400367 |
| Molecular Formula | C9H14N2O4 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | (2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-3-yl) acetate |
| SMILES | CC(=O)ON1CC2(CCNCC2)OC1=O |
| InChI | InChI=1S/C9H14N2O4/c1-7(12)15-11-6-9(14-8(11)13)2-4-10-5-3-9/h10H,2-6H2,1H3 |
| InChIKey | RVLYVAGDKLLBOQ-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |