C15H16N2O3S — CID 3585513
methyl 1-acetyl-4-methylidene-6-phenyl-2-sulfanylidene-1,3-diazinane-5-carboxylate (PubChem CID 3585513) has the molecular formula C15H16N2O3S and a molecular weight of 304.37 g/mol. Its IUPAC name is methyl 1-acetyl-4-methylidene-6-phenyl-2-sulfanylidene-1,3-diazinane-5-carboxylate.
| Compound Name | methyl 1-acetyl-4-methylidene-6-phenyl-2-sulfanylidene-1,3-diazinane-5-carboxylate |
|---|---|
| PubChem CID | 3585513 |
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | methyl 1-acetyl-4-methylidene-6-phenyl-2-sulfanylidene-1,3-diazinane-5-carboxylate |
| SMILES | C=C1NC(=S)N(C(C)=O)C(c2ccccc2)C1C(=O)OC |
| InChI | InChI=1S/C15H16N2O3S/c1-9-12(14(19)20-3)13(11-7-5-4-6-8-11)17(10(2)18)15(21)16-9/h4-8,12-13H,1H2,2-3H3,(H,16,21) |
| InChIKey | IOAOTYVKCZMWKF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|