C15H16N2O4S — CID 852581
methyl (1R,9R,13S)-12-acetyl-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-13-carboxylate (PubChem CID 852581) has the molecular formula C15H16N2O4S and a molecular weight of 320.37 g/mol. Its IUPAC name is methyl (1R,9R,13S)-12-acetyl-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-13-carboxylate.
| Compound Name | methyl (1R,9R,13S)-12-acetyl-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-13-carboxylate |
|---|---|
| PubChem CID | 852581 |
| Molecular Formula | C15H16N2O4S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | methyl (1R,9R,13S)-12-acetyl-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-13-carboxylate |
| SMILES | COC(=O)[C@H]1[C@@H]2c3ccccc3O[C@@]1(C)NC(=S)N2C(C)=O |
| InChI | InChI=1S/C15H16N2O4S/c1-8(18)17-12-9-6-4-5-7-10(9)21-15(2,16-14(17)22)11(12)13(19)20-3/h4-7,11-12H,1-3H3,(H,16,22)/t11-,12+,15-/m1/s1 |
| InChIKey | PNPIKNKUTPBYED-TYNCELHUSA-N |
| XLogP | 1.36 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|