About [1,3-bis(sulfanylidene)isoindol-2-yl] acetate
[1,3-bis(sulfanylidene)isoindol-2-yl] acetate (PubChem CID 129117659) has the molecular formula C10H7NO2S2
and a molecular weight of 237.31 g/mol. Its IUPAC name is [1,3-bis(sulfanylidene)isoindol-2-yl] acetate.
Molecular Properties
| Compound Name | [1,3-bis(sulfanylidene)isoindol-2-yl] acetate |
| PubChem CID | 129117659 |
| Molecular Formula | C10H7NO2S2 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 236.99 |
| IUPAC Name | [1,3-bis(sulfanylidene)isoindol-2-yl] acetate |
| SMILES | CC(=O)ON1C(=S)c2ccccc2C1=S |
| InChI | InChI=1S/C10H7NO2S2/c1-6(12)13-11-9(14)7-4-2-3-5-8(7)10(11)15/h2-5H,1H3 |
| InChIKey | GTZSFEVOSRCCBE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [1,3-bis(sulfanylidene)isoindol-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3-bis(sulfanylidene)isoindol-2-yl] acetate?
The IUPAC name of [1,3-bis(sulfanylidene)isoindol-2-yl] acetate (CID 129117659) is [1,3-bis(sulfanylidene)isoindol-2-yl] acetate.
What is the SMILES notation for [1,3-bis(sulfanylidene)isoindol-2-yl] acetate?
The canonical SMILES for [1,3-bis(sulfanylidene)isoindol-2-yl] acetate is CC(=O)ON1C(=S)c2ccccc2C1=S.
What is the InChIKey of [1,3-bis(sulfanylidene)isoindol-2-yl] acetate?
The InChIKey is GTZSFEVOSRCCBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO2S2/c1-6(12)13-11-9(14)7-4-2-3-5-8(7)10(11)15/h2-5H,1H3.
What are the key properties of [1,3-bis(sulfanylidene)isoindol-2-yl] acetate?
[1,3-bis(sulfanylidene)isoindol-2-yl] acetate has a molecular weight of 237.31 g/mol, XLogP of 1.83, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3-bis(sulfanylidene)isoindol-2-yl] acetate is sourced from PubChem (CID 129117659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).