C18H13NO4S2 — CID 175038836
[2,5-dioxo-3,4-bis(phenylsulfanyl)pyrrol-1-yl] acetate (PubChem CID 175038836) has the molecular formula C18H13NO4S2 and a molecular weight of 371.44 g/mol. Its IUPAC name is [2,5-dioxo-3,4-bis(phenylsulfanyl)pyrrol-1-yl] acetate.
| Compound Name | [2,5-dioxo-3,4-bis(phenylsulfanyl)pyrrol-1-yl] acetate |
|---|---|
| PubChem CID | 175038836 |
| Molecular Formula | C18H13NO4S2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | [2,5-dioxo-3,4-bis(phenylsulfanyl)pyrrol-1-yl] acetate |
| SMILES | CC(=O)ON1C(=O)C(Sc2ccccc2)=C(Sc2ccccc2)C1=O |
| InChI | InChI=1S/C18H13NO4S2/c1-12(20)23-19-17(21)15(24-13-8-4-2-5-9-13)16(18(19)22)25-14-10-6-3-7-11-14/h2-11H,1H3 |
| InChIKey | MRSAFEMAZBLLKS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|