C22H18O3S — CID 15415844
(1-oxo-10-phenylsulfanyl-3,4-dihydro-2H-anthracen-9-yl) acetate (PubChem CID 15415844) has the molecular formula C22H18O3S and a molecular weight of 362.45 g/mol. Its IUPAC name is (1-oxo-10-phenylsulfanyl-3,4-dihydro-2H-anthracen-9-yl) acetate.
| Compound Name | (1-oxo-10-phenylsulfanyl-3,4-dihydro-2H-anthracen-9-yl) acetate |
|---|---|
| PubChem CID | 15415844 |
| Molecular Formula | C22H18O3S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | (1-oxo-10-phenylsulfanyl-3,4-dihydro-2H-anthracen-9-yl) acetate |
| SMILES | CC(=O)Oc1c2c(c(Sc3ccccc3)c3ccccc13)CCCC2=O |
| InChI | InChI=1S/C22H18O3S/c1-14(23)25-21-16-10-5-6-11-17(16)22(26-15-8-3-2-4-9-15)18-12-7-13-19(24)20(18)21/h2-6,8-11H,7,12-13H2,1H3 |
| InChIKey | LHQQIXRGQNMYIC-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|