C22H16N2O6S2 — CID 155661409
2-[2,5-dioxo-3,4-bis(phenylsulfanyl)pyrrol-1-yl]-2-(2,5-dioxopyrrolidin-1-yl)acetic acid (PubChem CID 155661409) has the molecular formula C22H16N2O6S2 and a molecular weight of 468.51 g/mol. Its IUPAC name is 2-[2,5-dioxo-3,4-bis(phenylsulfanyl)pyrrol-1-yl]-2-(2,5-dioxopyrrolidin-1-yl)acetic acid.
| Compound Name | 2-[2,5-dioxo-3,4-bis(phenylsulfanyl)pyrrol-1-yl]-2-(2,5-dioxopyrrolidin-1-yl)acetic acid |
|---|---|
| PubChem CID | 155661409 |
| Molecular Formula | C22H16N2O6S2 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.04 |
| IUPAC Name | 2-[2,5-dioxo-3,4-bis(phenylsulfanyl)pyrrol-1-yl]-2-(2,5-dioxopyrrolidin-1-yl)acetic acid |
| SMILES | O=C(O)C(N1C(=O)CCC1=O)N1C(=O)C(Sc2ccccc2)=C(Sc2ccccc2)C1=O |
| InChI | InChI=1S/C22H16N2O6S2/c25-15-11-12-16(26)23(15)19(22(29)30)24-20(27)17(31-13-7-3-1-4-8-13)18(21(24)28)32-14-9-5-2-6-10-14/h1-10,19H,11-12H2,(H,29,30) |
| InChIKey | JBNRBYXTKPDCBZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|