C20H20N2O6 — CID 70230036
1-[1-[3-[1-(2,5-dioxopyrrolidin-1-yl)-2-oxopropyl]phenyl]-2-oxopropyl]pyrrolidine-2,5-dione (PubChem CID 70230036) has the molecular formula C20H20N2O6 and a molecular weight of 384.39 g/mol. Its IUPAC name is 1-[1-[3-[1-(2,5-dioxopyrrolidin-1-yl)-2-oxopropyl]phenyl]-2-oxopropyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[1-[3-[1-(2,5-dioxopyrrolidin-1-yl)-2-oxopropyl]phenyl]-2-oxopropyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 70230036 |
| Molecular Formula | C20H20N2O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 1-[1-[3-[1-(2,5-dioxopyrrolidin-1-yl)-2-oxopropyl]phenyl]-2-oxopropyl]pyrrolidine-2,5-dione |
| SMILES | CC(=O)C(c1cccc(C(C(C)=O)N2C(=O)CCC2=O)c1)N1C(=O)CCC1=O |
| InChI | InChI=1S/C20H20N2O6/c1-11(23)19(21-15(25)6-7-16(21)26)13-4-3-5-14(10-13)20(12(2)24)22-17(27)8-9-18(22)28/h3-5,10,19-20H,6-9H2,1-2H3 |
| InChIKey | PTMPFMCITKUYNP-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|