C19H20N4O3 — CID 167842755
N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-(2,5-dioxopyrrolidin-1-yl)-2-phenylacetamide (PubChem CID 167842755) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-(2,5-dioxopyrrolidin-1-yl)-2-phenylacetamide.
| Compound Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-(2,5-dioxopyrrolidin-1-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 167842755 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-(2,5-dioxopyrrolidin-1-yl)-2-phenylacetamide |
| SMILES | C#CCCC1(CCNC(=O)C(c2ccccc2)N2C(=O)CCC2=O)N=N1 |
| InChI | InChI=1S/C19H20N4O3/c1-2-3-11-19(21-22-19)12-13-20-18(26)17(14-7-5-4-6-8-14)23-15(24)9-10-16(23)25/h1,4-8,17H,3,9-13H2,(H,20,26) |
| InChIKey | GLPZYRGQLWCPHB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 91.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|