C22H24N4O — CID 170459500
(2S)-2-amino-N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-3,3-diphenylpropanamide (PubChem CID 170459500) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-3,3-diphenylpropanamide.
| Compound Name | (2S)-2-amino-N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-3,3-diphenylpropanamide |
|---|---|
| PubChem CID | 170459500 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | (2S)-2-amino-N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-3,3-diphenylpropanamide |
| SMILES | C#CCCC1(CCNC(=O)[C@@H](N)C(c2ccccc2)c2ccccc2)N=N1 |
| InChI | InChI=1S/C22H24N4O/c1-2-3-14-22(25-26-22)15-16-24-21(27)20(23)19(17-10-6-4-7-11-17)18-12-8-5-9-13-18/h1,4-13,19-20H,3,14-16,23H2,(H,24,27)/t20-/m0/s1 |
| InChIKey | ISLWAOXHYFJHRM-FQEVSTJZSA-N |
| XLogP | 3.23 |
| TPSA | 79.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|