C20H25N3O3 — CID 166416568
N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-4-phenylmethoxyoxane-4-carboxamide (PubChem CID 166416568) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-4-phenylmethoxyoxane-4-carboxamide.
| Compound Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-4-phenylmethoxyoxane-4-carboxamide |
|---|---|
| PubChem CID | 166416568 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-4-phenylmethoxyoxane-4-carboxamide |
| SMILES | C#CCCC1(CCNC(=O)C2(OCc3ccccc3)CCOCC2)N=N1 |
| InChI | InChI=1S/C20H25N3O3/c1-2-3-9-20(22-23-20)10-13-21-18(24)19(11-14-25-15-12-19)26-16-17-7-5-4-6-8-17/h1,4-8H,3,9-16H2,(H,21,24) |
| InChIKey | STFHJTJFZJODHB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|