C22H26N2O4 — CID 139725454
(4S,5S)-1-[(2S)-3,3-dimethoxy-2-methylpropanoyl]-3-methyl-4,5-diphenylimidazolidin-2-one (PubChem CID 139725454) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is (4S,5S)-1-[(2S)-3,3-dimethoxy-2-methylpropanoyl]-3-methyl-4,5-diphenylimidazolidin-2-one.
| Compound Name | (4S,5S)-1-[(2S)-3,3-dimethoxy-2-methylpropanoyl]-3-methyl-4,5-diphenylimidazolidin-2-one |
|---|---|
| PubChem CID | 139725454 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | (4S,5S)-1-[(2S)-3,3-dimethoxy-2-methylpropanoyl]-3-methyl-4,5-diphenylimidazolidin-2-one |
| SMILES | COC(OC)[C@H](C)C(=O)N1C(=O)N(C)[C@@H](c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H26N2O4/c1-15(21(27-3)28-4)20(25)24-19(17-13-9-6-10-14-17)18(23(2)22(24)26)16-11-7-5-8-12-16/h5-15,18-19,21H,1-4H3/t15-,18+,19+/m1/s1 |
| InChIKey | ZIRLUTWLYFYRDA-MNEFBYGVSA-N |
| XLogP | 3.62 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|