C17H22N2O2 — CID 11087392
(4S,5R)-1,5-dimethyl-3-[(E)-4-methylpent-2-enoyl]-4-phenylimidazolidin-2-one (PubChem CID 11087392) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is (4S,5R)-1,5-dimethyl-3-[(E)-4-methylpent-2-enoyl]-4-phenylimidazolidin-2-one.
| Compound Name | (4S,5R)-1,5-dimethyl-3-[(E)-4-methylpent-2-enoyl]-4-phenylimidazolidin-2-one |
|---|---|
| PubChem CID | 11087392 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (4S,5R)-1,5-dimethyl-3-[(E)-4-methylpent-2-enoyl]-4-phenylimidazolidin-2-one |
| SMILES | CC(C)/C=C/C(=O)N1C(=O)N(C)[C@H](C)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H22N2O2/c1-12(2)10-11-15(20)19-16(13(3)18(4)17(19)21)14-8-6-5-7-9-14/h5-13,16H,1-4H3/b11-10+/t13-,16-/m1/s1 |
| InChIKey | GZOWSJWTBNJLQQ-DRWRZZHCSA-N |
| XLogP | 3.22 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|