C15H17N3O4 — CID 101112759
N-[2-[(4S,5R)-3,4-dimethyl-2-oxo-5-phenylimidazolidin-1-yl]-2-oxoethyl]-N-formylformamide (PubChem CID 101112759) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is N-[2-[(4S,5R)-3,4-dimethyl-2-oxo-5-phenylimidazolidin-1-yl]-2-oxoethyl]-N-formylformamide.
| Compound Name | N-[2-[(4S,5R)-3,4-dimethyl-2-oxo-5-phenylimidazolidin-1-yl]-2-oxoethyl]-N-formylformamide |
|---|---|
| PubChem CID | 101112759 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | N-[2-[(4S,5R)-3,4-dimethyl-2-oxo-5-phenylimidazolidin-1-yl]-2-oxoethyl]-N-formylformamide |
| SMILES | C[C@H]1[C@@H](c2ccccc2)N(C(=O)CN(C=O)C=O)C(=O)N1C |
| InChI | InChI=1S/C15H17N3O4/c1-11-14(12-6-4-3-5-7-12)18(15(22)16(11)2)13(21)8-17(9-19)10-20/h3-7,9-11,14H,8H2,1-2H3/t11-,14-/m0/s1 |
| InChIKey | DKGIFTQJQBXEFK-FZMZJTMJSA-N |
| XLogP | 0.62 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|