C21H23BrN2O2 — CID 139179430
(4S,5R)-1-[(2S)-2-bromo-4-phenylbutanoyl]-3,4-dimethyl-5-phenylimidazolidin-2-one (PubChem CID 139179430) has the molecular formula C21H23BrN2O2 and a molecular weight of 415.33 g/mol. Its IUPAC name is (4S,5R)-1-[(2S)-2-bromo-4-phenylbutanoyl]-3,4-dimethyl-5-phenylimidazolidin-2-one.
| Compound Name | (4S,5R)-1-[(2S)-2-bromo-4-phenylbutanoyl]-3,4-dimethyl-5-phenylimidazolidin-2-one |
|---|---|
| PubChem CID | 139179430 |
| Molecular Formula | C21H23BrN2O2 |
| Molecular Weight | 415.33 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | (4S,5R)-1-[(2S)-2-bromo-4-phenylbutanoyl]-3,4-dimethyl-5-phenylimidazolidin-2-one |
| SMILES | C[C@H]1[C@@H](c2ccccc2)N(C(=O)[C@@H](Br)CCc2ccccc2)C(=O)N1C |
| InChI | InChI=1S/C21H23BrN2O2/c1-15-19(17-11-7-4-8-12-17)24(21(26)23(15)2)20(25)18(22)14-13-16-9-5-3-6-10-16/h3-12,15,18-19H,13-14H2,1-2H3/t15-,18-,19-/m0/s1 |
| InChIKey | QIISGWORGDXJST-SNRMKQJTSA-N |
| XLogP | 4.41 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.33 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|