C20H33N2+ — CID 57256137
1-(2,6-ditert-butylphenyl)-3-propan-2-yl-4,5-dihydroimidazol-3-ium (PubChem CID 57256137) has the molecular formula C20H33N2+ and a molecular weight of 301.50 g/mol. Its IUPAC name is 1-(2,6-ditert-butylphenyl)-3-propan-2-yl-4,5-dihydroimidazol-3-ium.
| Compound Name | 1-(2,6-ditert-butylphenyl)-3-propan-2-yl-4,5-dihydroimidazol-3-ium |
|---|---|
| PubChem CID | 57256137 |
| Molecular Formula | C20H33N2+ |
| Molecular Weight | 301.50 g/mol |
| Exact Mass | 301.26 |
| IUPAC Name | 1-(2,6-ditert-butylphenyl)-3-propan-2-yl-4,5-dihydroimidazol-3-ium |
| SMILES | CC(C)[N+]1=CN(c2c(C(C)(C)C)cccc2C(C)(C)C)CC1 |
| InChI | InChI=1S/C20H33N2/c1-15(2)21-12-13-22(14-21)18-16(19(3,4)5)10-9-11-17(18)20(6,7)8/h9-11,14-15H,12-13H2,1-8H3/q+1 |
| InChIKey | MGOASGKSRFTLNE-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|