C47H79N2+ — CID 18354170
1,3-bis[2,6-bis(2,5-dimethylhexan-2-yl)phenyl]-4,5-dihydroimidazol-1-ium (PubChem CID 18354170) has the molecular formula C47H79N2+ and a molecular weight of 672.16 g/mol. Its IUPAC name is 1,3-bis[2,6-bis(2,5-dimethylhexan-2-yl)phenyl]-4,5-dihydroimidazol-1-ium.
| Compound Name | 1,3-bis[2,6-bis(2,5-dimethylhexan-2-yl)phenyl]-4,5-dihydroimidazol-1-ium |
|---|---|
| PubChem CID | 18354170 |
| Molecular Formula | C47H79N2+ |
| Molecular Weight | 672.16 g/mol |
| Exact Mass | 671.62 |
| IUPAC Name | 1,3-bis[2,6-bis(2,5-dimethylhexan-2-yl)phenyl]-4,5-dihydroimidazol-1-ium |
| SMILES | CC(C)CCC(C)(C)c1cccc(C(C)(C)CCC(C)C)c1N1C=[N+](c2c(C(C)(C)CCC(C)C)cccc2C(C)(C)CCC(C)C)CC1 |
| InChI | InChI=1S/C47H79N2/c1-34(2)23-27-44(9,10)38-19-17-20-39(45(11,12)28-24-35(3)4)42(38)48-31-32-49(33-48)43-40(46(13,14)29-25-36(5)6)21-18-22-41(43)47(15,16)30-26-37(7)8/h17-22,33-37H,23-32H2,1-16H3/q+1 |
| InChIKey | DESKQWUWLJKVAS-UHFFFAOYSA-N |
| XLogP | 13.73 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.16 |
| LogP ≤ 5 | 13.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|