About (2S)-2-[3-[2,6-di(propan-2-yl)phenyl]imidazolidin-1-yl]-3,3-dimethylbutan-1-ol
(2S)-2-[3-[2,6-di(propan-2-yl)phenyl]imidazolidin-1-yl]-3,3-dimethylbutan-1-ol (PubChem CID 134943461) has the molecular formula C21H36N2O
and a molecular weight of 332.53 g/mol. Its IUPAC name is (2S)-2-[3-[2,6-di(propan-2-yl)phenyl]imidazolidin-1-yl]-3,3-dimethylbutan-1-ol.
Molecular Properties
| Compound Name | (2S)-2-[3-[2,6-di(propan-2-yl)phenyl]imidazolidin-1-yl]-3,3-dimethylbutan-1-ol |
| PubChem CID | 134943461 |
| Molecular Formula | C21H36N2O |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.28 |
| IUPAC Name | (2S)-2-[3-[2,6-di(propan-2-yl)phenyl]imidazolidin-1-yl]-3,3-dimethylbutan-1-ol |
| SMILES | CC(C)c1cccc(C(C)C)c1N1CCN([C@H](CO)C(C)(C)C)C1 |
| InChI | InChI=1S/C21H36N2O/c1-15(2)17-9-8-10-18(16(3)4)20(17)23-12-11-22(14-23)19(13-24)21(5,6)7/h8-10,15-16,19,24H,11-14H2,1-7H3/t19-/m1/s1 |
| InChIKey | DIEQSVVDSWGJJO-LJQANCHMSA-N |
| XLogP | 4.42 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-[3-[2,6-di(propan-2-yl)phenyl]imidazolidin-1-yl]-3,3-dimethylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[3-[2,6-di(propan-2-yl)phenyl]imidazolidin-1-yl]-3,3-dimethylbutan-1-ol?
The IUPAC name of (2S)-2-[3-[2,6-di(propan-2-yl)phenyl]imidazolidin-1-yl]-3,3-dimethylbutan-1-ol (CID 134943461) is (2S)-2-[3-[2,6-di(propan-2-yl)phenyl]imidazolidin-1-yl]-3,3-dimethylbutan-1-ol.
What is the SMILES notation for (2S)-2-[3-[2,6-di(propan-2-yl)phenyl]imidazolidin-1-yl]-3,3-dimethylbutan-1-ol?
The canonical SMILES for (2S)-2-[3-[2,6-di(propan-2-yl)phenyl]imidazolidin-1-yl]-3,3-dimethylbutan-1-ol is CC(C)c1cccc(C(C)C)c1N1CCN([C@H](CO)C(C)(C)C)C1.
What is the InChIKey of (2S)-2-[3-[2,6-di(propan-2-yl)phenyl]imidazolidin-1-yl]-3,3-dimethylbutan-1-ol?
The InChIKey is DIEQSVVDSWGJJO-LJQANCHMSA-N. The full InChI is InChI=1S/C21H36N2O/c1-15(2)17-9-8-10-18(16(3)4)20(17)23-12-11-22(14-23)19(13-24)21(5,6)7/h8-10,15-16,19,24H,11-14H2,1-7H3/t19-/m1/s1.
What are the key properties of (2S)-2-[3-[2,6-di(propan-2-yl)phenyl]imidazolidin-1-yl]-3,3-dimethylbutan-1-ol?
(2S)-2-[3-[2,6-di(propan-2-yl)phenyl]imidazolidin-1-yl]-3,3-dimethylbutan-1-ol has a molecular weight of 332.53 g/mol, XLogP of 4.42, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[3-[2,6-di(propan-2-yl)phenyl]imidazolidin-1-yl]-3,3-dimethylbutan-1-ol is sourced from PubChem (CID 134943461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).