C27H44N2 — CID 118501339
1-[2,6-di(propan-2-yl)phenyl]-3-[(3R)-6-methyl-5-methylidene-3-propan-2-ylhept-1-en-4-yl]imidazolidine (PubChem CID 118501339) has the molecular formula C27H44N2 and a molecular weight of 396.66 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-[(3R)-6-methyl-5-methylidene-3-propan-2-ylhept-1-en-4-yl]imidazolidine.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-[(3R)-6-methyl-5-methylidene-3-propan-2-ylhept-1-en-4-yl]imidazolidine |
|---|---|
| PubChem CID | 118501339 |
| Molecular Formula | C27H44N2 |
| Molecular Weight | 396.66 g/mol |
| Exact Mass | 396.35 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-[(3R)-6-methyl-5-methylidene-3-propan-2-ylhept-1-en-4-yl]imidazolidine |
| SMILES | C=C[C@@H](C(C)C)C(C(=C)C(C)C)N1CCN(c2c(C(C)C)cccc2C(C)C)C1 |
| InChI | InChI=1S/C27H44N2/c1-11-23(19(4)5)26(22(10)18(2)3)28-15-16-29(17-28)27-24(20(6)7)13-12-14-25(27)21(8)9/h11-14,18-21,23,26H,1,10,15-17H2,2-9H3/t23-,26?/m0/s1 |
| InChIKey | UZHHGEBQOUGURI-ZZHFZYNASA-N |
| XLogP | 7.05 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.66 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|