C19H31IN2 — CID 25195332
1-butyl-3-[2,6-di(propan-2-yl)phenyl]-4,5-dihydroimidazol-1-ium iodide (PubChem CID 25195332) has the molecular formula C19H31IN2 and a molecular weight of 414.38 g/mol. Its IUPAC name is 1-butyl-3-[2,6-di(propan-2-yl)phenyl]-4,5-dihydroimidazol-1-ium iodide.
| Compound Name | 1-butyl-3-[2,6-di(propan-2-yl)phenyl]-4,5-dihydroimidazol-1-ium iodide |
|---|---|
| PubChem CID | 25195332 |
| Molecular Formula | C19H31IN2 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 1-butyl-3-[2,6-di(propan-2-yl)phenyl]-4,5-dihydroimidazol-1-ium iodide |
| SMILES | CCCC[N+]1=CN(c2c(C(C)C)cccc2C(C)C)CC1.[I-] |
| InChI | InChI=1S/C19H31N2.HI/c1-6-7-11-20-12-13-21(14-20)19-17(15(2)3)9-8-10-18(19)16(4)5;/h8-10,14-16H,6-7,11-13H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | FWBXKUUORANRBK-UHFFFAOYSA-M |
| XLogP | 1.60 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|