C27H34AuClN3- — CID 172516529
chlorogold;2-[2,6-di(propan-2-yl)phenyl]-N,N-diethyl-1H-imidazo[1,5-a]quinolin-1-id-9-amine (PubChem CID 172516529) has the molecular formula C27H34AuClN3- and a molecular weight of 633.01 g/mol. Its IUPAC name is chlorogold;2-[2,6-di(propan-2-yl)phenyl]-N,N-diethyl-1H-imidazo[1,5-a]quinolin-1-id-9-amine.
| Compound Name | chlorogold;2-[2,6-di(propan-2-yl)phenyl]-N,N-diethyl-1H-imidazo[1,5-a]quinolin-1-id-9-amine |
|---|---|
| PubChem CID | 172516529 |
| Molecular Formula | C27H34AuClN3- |
| Molecular Weight | 633.01 g/mol |
| Exact Mass | 632.21 |
| IUPAC Name | chlorogold;2-[2,6-di(propan-2-yl)phenyl]-N,N-diethyl-1H-imidazo[1,5-a]quinolin-1-id-9-amine |
| SMILES | CCN(CC)c1cccc2c1N1[CH-]N(c3c(C(C)C)cccc3C(C)C)C=C1C=C2.Cl[Au] |
| InChI | InChI=1S/C27H34N3.Au.ClH/c1-7-28(8-2)25-14-9-11-21-15-16-22-17-29(18-30(22)26(21)25)27-23(19(3)4)12-10-13-24(27)20(5)6;;/h9-20H,7-8H2,1-6H3;;1H/q-1;+1;/p-1 |
| InChIKey | HJYFCTQEKHSBBQ-UHFFFAOYSA-M |
| XLogP | 7.78 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.01 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|