C18H26N2 — CID 12673049
1-N,1-N,8-N,8-N-tetraethylnaphthalene-1,8-diamine (PubChem CID 12673049) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 1-N,1-N,8-N,8-N-tetraethylnaphthalene-1,8-diamine.
| Compound Name | 1-N,1-N,8-N,8-N-tetraethylnaphthalene-1,8-diamine |
|---|---|
| PubChem CID | 12673049 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 1-N,1-N,8-N,8-N-tetraethylnaphthalene-1,8-diamine |
| SMILES | CCN(CC)c1cccc2cccc(N(CC)CC)c12 |
| InChI | InChI=1S/C18H26N2/c1-5-19(6-2)16-13-9-11-15-12-10-14-17(18(15)16)20(7-3)8-4/h9-14H,5-8H2,1-4H3 |
| InChIKey | GOXVZGOCBRLZOO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |