C20H28N2 — CID 158417392
2-[2-(diethylamino)phenyl]-N,N-diethylaniline (PubChem CID 158417392) has the molecular formula C20H28N2 and a molecular weight of 296.46 g/mol. Its IUPAC name is 2-[2-(diethylamino)phenyl]-N,N-diethylaniline.
| Compound Name | 2-[2-(diethylamino)phenyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 158417392 |
| Molecular Formula | C20H28N2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | 2-[2-(diethylamino)phenyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccccc1-c1ccccc1N(CC)CC |
| InChI | InChI=1S/C20H28N2/c1-5-21(6-2)19-15-11-9-13-17(19)18-14-10-12-16-20(18)22(7-3)8-4/h9-16H,5-8H2,1-4H3 |
| InChIKey | HABKARBNMXZFLC-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |