C28H29NSn — CID 159469705
N,N-diethyl-2-triphenylstannylaniline (PubChem CID 159469705) has the molecular formula C28H29NSn and a molecular weight of 498.26 g/mol. Its IUPAC name is N,N-diethyl-2-triphenylstannylaniline.
| Compound Name | N,N-diethyl-2-triphenylstannylaniline |
|---|---|
| PubChem CID | 159469705 |
| Molecular Formula | C28H29NSn |
| Molecular Weight | 498.26 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | N,N-diethyl-2-triphenylstannylaniline |
| SMILES | CCN(CC)c1ccccc1[Sn](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C10H14N.3C6H5.Sn/c1-3-11(4-2)10-8-6-5-7-9-10;3*1-2-4-6-5-3-1;/h5-8H,3-4H2,1-2H3;3*1-5H; |
| InChIKey | LVQLWDWAGCEZMT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.26 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |