C18H25NSi — CID 86066559
2-[dimethyl(phenyl)silyl]-N,N-diethylaniline (PubChem CID 86066559) has the molecular formula C18H25NSi and a molecular weight of 283.49 g/mol. Its IUPAC name is 2-[dimethyl(phenyl)silyl]-N,N-diethylaniline.
| Compound Name | 2-[dimethyl(phenyl)silyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 86066559 |
| Molecular Formula | C18H25NSi |
| Molecular Weight | 283.49 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 2-[dimethyl(phenyl)silyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccccc1[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C18H25NSi/c1-5-19(6-2)17-14-10-11-15-18(17)20(3,4)16-12-8-7-9-13-16/h7-15H,5-6H2,1-4H3 |
| InChIKey | DPVKSIPRKLWPSQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|