C27H27NOSi — CID 23642962
[2-[dimethyl-[4-(N-phenylanilino)phenyl]silyl]phenyl]methanol (PubChem CID 23642962) has the molecular formula C27H27NOSi and a molecular weight of 409.61 g/mol. Its IUPAC name is [2-[dimethyl-[4-(N-phenylanilino)phenyl]silyl]phenyl]methanol.
| Compound Name | [2-[dimethyl-[4-(N-phenylanilino)phenyl]silyl]phenyl]methanol |
|---|---|
| PubChem CID | 23642962 |
| Molecular Formula | C27H27NOSi |
| Molecular Weight | 409.61 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | [2-[dimethyl-[4-(N-phenylanilino)phenyl]silyl]phenyl]methanol |
| SMILES | C[Si](C)(c1ccc(N(c2ccccc2)c2ccccc2)cc1)c1ccccc1CO |
| InChI | InChI=1S/C27H27NOSi/c1-30(2,27-16-10-9-11-22(27)21-29)26-19-17-25(18-20-26)28(23-12-5-3-6-13-23)24-14-7-4-8-15-24/h3-20,29H,21H2,1-2H3 |
| InChIKey | JIGJXZQBGQVASP-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.61 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|