C20H19Cl2NSi — CID 23434748
4-[dichloro(ethyl)silyl]-N,N-diphenylaniline (PubChem CID 23434748) has the molecular formula C20H19Cl2NSi and a molecular weight of 372.37 g/mol. Its IUPAC name is 4-[dichloro(ethyl)silyl]-N,N-diphenylaniline.
| Compound Name | 4-[dichloro(ethyl)silyl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 23434748 |
| Molecular Formula | C20H19Cl2NSi |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 4-[dichloro(ethyl)silyl]-N,N-diphenylaniline |
| SMILES | CC[Si](Cl)(Cl)c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H19Cl2NSi/c1-2-24(21,22)20-15-13-19(14-16-20)23(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-16H,2H2,1H3 |
| InChIKey | HJFGKOQUGXVWQI-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|