About 2-(diethylamino)phenol;phenol
2-(diethylamino)phenol;phenol (PubChem CID 174799209) has the molecular formula C16H21NO2
and a molecular weight of 259.35 g/mol. Its IUPAC name is 2-(diethylamino)phenol;phenol.
Molecular Properties
| Compound Name | 2-(diethylamino)phenol;phenol |
| PubChem CID | 174799209 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 2-(diethylamino)phenol;phenol |
| SMILES | CCN(CC)c1ccccc1O.Oc1ccccc1 |
| InChI | InChI=1S/C10H15NO.C6H6O/c1-3-11(4-2)9-7-5-6-8-10(9)12;7-6-4-2-1-3-5-6/h5-8,12H,3-4H2,1-2H3;1-5,7H |
| InChIKey | RNVOHMRHBFWJLZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(diethylamino)phenol;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)phenol;phenol?
The IUPAC name of 2-(diethylamino)phenol;phenol (CID 174799209) is 2-(diethylamino)phenol;phenol.
What is the SMILES notation for 2-(diethylamino)phenol;phenol?
The canonical SMILES for 2-(diethylamino)phenol;phenol is CCN(CC)c1ccccc1O.Oc1ccccc1.
What is the InChIKey of 2-(diethylamino)phenol;phenol?
The InChIKey is RNVOHMRHBFWJLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO.C6H6O/c1-3-11(4-2)9-7-5-6-8-10(9)12;7-6-4-2-1-3-5-6/h5-8,12H,3-4H2,1-2H3;1-5,7H.
What are the key properties of 2-(diethylamino)phenol;phenol?
2-(diethylamino)phenol;phenol has a molecular weight of 259.35 g/mol, XLogP of 3.63, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)phenol;phenol is sourced from PubChem (CID 174799209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).