About sodium;2-(diethylamino)phenol;tetraphenylboranuide
sodium;2-(diethylamino)phenol;tetraphenylboranuide (PubChem CID 174902980) has the molecular formula C34H35BNNaO
and a molecular weight of 507.46 g/mol. Its IUPAC name is sodium;2-(diethylamino)phenol;tetraphenylboranuide.
Molecular Properties
| Compound Name | sodium;2-(diethylamino)phenol;tetraphenylboranuide |
| PubChem CID | 174902980 |
| Molecular Formula | C34H35BNNaO |
| Molecular Weight | 507.46 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | sodium;2-(diethylamino)phenol;tetraphenylboranuide |
| SMILES | CCN(CC)c1ccccc1O.[Na+].c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20B.C10H15NO.Na/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-3-11(4-2)9-7-5-6-8-10(9)12;/h1-20H;5-8,12H,3-4H2,1-2H3;/q-1;;+1 |
| InChIKey | OQQVCUQSTPPWPD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 507.46 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze sodium;2-(diethylamino)phenol;tetraphenylboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-(diethylamino)phenol;tetraphenylboranuide?
The IUPAC name of sodium;2-(diethylamino)phenol;tetraphenylboranuide (CID 174902980) is sodium;2-(diethylamino)phenol;tetraphenylboranuide.
What is the SMILES notation for sodium;2-(diethylamino)phenol;tetraphenylboranuide?
The canonical SMILES for sodium;2-(diethylamino)phenol;tetraphenylboranuide is CCN(CC)c1ccccc1O.[Na+].c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of sodium;2-(diethylamino)phenol;tetraphenylboranuide?
The InChIKey is OQQVCUQSTPPWPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20B.C10H15NO.Na/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-3-11(4-2)9-7-5-6-8-10(9)12;/h1-20H;5-8,12H,3-4H2,1-2H3;/q-1;;+1.
What are the key properties of sodium;2-(diethylamino)phenol;tetraphenylboranuide?
sodium;2-(diethylamino)phenol;tetraphenylboranuide has a molecular weight of 507.46 g/mol, XLogP of 2.31, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-(diethylamino)phenol;tetraphenylboranuide is sourced from PubChem (CID 174902980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).