C48H66N4O3 — CID 139721066
1-[4,4-bis[2-(diethylamino)phenyl]-2-hydroxybut-1-enoxy]-4,4-bis[2-(diethylamino)phenyl]but-1-en-2-ol (PubChem CID 139721066) has the molecular formula C48H66N4O3 and a molecular weight of 747.08 g/mol. Its IUPAC name is 1-[4,4-bis[2-(diethylamino)phenyl]-2-hydroxybut-1-enoxy]-4,4-bis[2-(diethylamino)phenyl]but-1-en-2-ol.
| Compound Name | 1-[4,4-bis[2-(diethylamino)phenyl]-2-hydroxybut-1-enoxy]-4,4-bis[2-(diethylamino)phenyl]but-1-en-2-ol |
|---|---|
| PubChem CID | 139721066 |
| Molecular Formula | C48H66N4O3 |
| Molecular Weight | 747.08 g/mol |
| Exact Mass | 746.51 |
| IUPAC Name | 1-[4,4-bis[2-(diethylamino)phenyl]-2-hydroxybut-1-enoxy]-4,4-bis[2-(diethylamino)phenyl]but-1-en-2-ol |
| SMILES | CCN(CC)c1ccccc1C(CC(O)=COC=C(O)CC(c1ccccc1N(CC)CC)c1ccccc1N(CC)CC)c1ccccc1N(CC)CC |
| InChI | InChI=1S/C48H66N4O3/c1-9-49(10-2)45-29-21-17-25-39(45)43(40-26-18-22-30-46(40)50(11-3)12-4)33-37(53)35-55-36-38(54)34-44(41-27-19-23-31-47(41)51(13-5)14-6)42-28-20-24-32-48(42)52(15-7)16-8/h17-32,35-36,43-44,53-54H,9-16,33-34H2,1-8H3 |
| InChIKey | ZTAYDUJFYFECMW-UHFFFAOYSA-N |
| XLogP | 11.63 |
| TPSA | 62.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.08 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|