C18H18F11NO — CID 162347554
1-[2-(diethylamino)phenyl]-2-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)ethanol (PubChem CID 162347554) has the molecular formula C18H18F11NO and a molecular weight of 473.33 g/mol. Its IUPAC name is 1-[2-(diethylamino)phenyl]-2-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)ethanol.
| Compound Name | 1-[2-(diethylamino)phenyl]-2-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)ethanol |
|---|---|
| PubChem CID | 162347554 |
| Molecular Formula | C18H18F11NO |
| Molecular Weight | 473.33 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | 1-[2-(diethylamino)phenyl]-2-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)ethanol |
| SMILES | CCN(CC)c1ccccc1C(O)CC1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C18H18F11NO/c1-3-30(4-2)11-8-6-5-7-10(11)12(31)9-13(19)14(20,21)16(24,25)18(28,29)17(26,27)15(13,22)23/h5-8,12,31H,3-4,9H2,1-2H3 |
| InChIKey | VGNCKJNAYCHZPK-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.33 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|