C14H8F12O — CID 162348022
2-(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl)-1-[2-(trifluoromethyl)phenyl]ethanol (PubChem CID 162348022) has the molecular formula C14H8F12O and a molecular weight of 420.19 g/mol. Its IUPAC name is 2-(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl)-1-[2-(trifluoromethyl)phenyl]ethanol.
| Compound Name | 2-(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl)-1-[2-(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 162348022 |
| Molecular Formula | C14H8F12O |
| Molecular Weight | 420.19 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | 2-(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl)-1-[2-(trifluoromethyl)phenyl]ethanol |
| SMILES | OC(CC1(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H8F12O/c15-9(11(19,20)13(23,24)14(25,26)12(9,21)22)5-8(27)6-3-1-2-4-7(6)10(16,17)18/h1-4,8,27H,5H2 |
| InChIKey | JKJJQMAQGDEVJO-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.19 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|