C15H11F9O3 — CID 162347935
[2-[1-hydroxy-2-(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl)ethyl]phenyl] acetate (PubChem CID 162347935) has the molecular formula C15H11F9O3 and a molecular weight of 410.23 g/mol. Its IUPAC name is [2-[1-hydroxy-2-(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl)ethyl]phenyl] acetate.
| Compound Name | [2-[1-hydroxy-2-(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl)ethyl]phenyl] acetate |
|---|---|
| PubChem CID | 162347935 |
| Molecular Formula | C15H11F9O3 |
| Molecular Weight | 410.23 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | [2-[1-hydroxy-2-(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl)ethyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1C(O)CC1(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C15H11F9O3/c1-7(25)27-10-5-3-2-4-8(10)9(26)6-11(16)12(17,18)14(21,22)15(23,24)13(11,19)20/h2-5,9,26H,6H2,1H3 |
| InChIKey | CWKPZSLPVNXDKC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.23 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|