C13H11F7O3 — CID 156764441
[2-[3,4,4,4-tetrafluoro-1-hydroxy-3-(trifluoromethyl)butyl]phenyl] acetate (PubChem CID 156764441) has the molecular formula C13H11F7O3 and a molecular weight of 348.21 g/mol. Its IUPAC name is [2-[3,4,4,4-tetrafluoro-1-hydroxy-3-(trifluoromethyl)butyl]phenyl] acetate.
| Compound Name | [2-[3,4,4,4-tetrafluoro-1-hydroxy-3-(trifluoromethyl)butyl]phenyl] acetate |
|---|---|
| PubChem CID | 156764441 |
| Molecular Formula | C13H11F7O3 |
| Molecular Weight | 348.21 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | [2-[3,4,4,4-tetrafluoro-1-hydroxy-3-(trifluoromethyl)butyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1C(O)CC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H11F7O3/c1-7(21)23-10-5-3-2-4-8(10)9(22)6-11(14,12(15,16)17)13(18,19)20/h2-5,9,22H,6H2,1H3 |
| InChIKey | AFZBBWWSMLJZFG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.21 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|