C40H50N4O3 — CID 139721068
1-[4,4-bis[2-(dimethylamino)phenyl]-2-hydroxybut-1-enoxy]-4,4-bis[2-(dimethylamino)phenyl]but-1-en-2-ol (PubChem CID 139721068) has the molecular formula C40H50N4O3 and a molecular weight of 634.86 g/mol. Its IUPAC name is 1-[4,4-bis[2-(dimethylamino)phenyl]-2-hydroxybut-1-enoxy]-4,4-bis[2-(dimethylamino)phenyl]but-1-en-2-ol.
| Compound Name | 1-[4,4-bis[2-(dimethylamino)phenyl]-2-hydroxybut-1-enoxy]-4,4-bis[2-(dimethylamino)phenyl]but-1-en-2-ol |
|---|---|
| PubChem CID | 139721068 |
| Molecular Formula | C40H50N4O3 |
| Molecular Weight | 634.86 g/mol |
| Exact Mass | 634.39 |
| IUPAC Name | 1-[4,4-bis[2-(dimethylamino)phenyl]-2-hydroxybut-1-enoxy]-4,4-bis[2-(dimethylamino)phenyl]but-1-en-2-ol |
| SMILES | CN(C)c1ccccc1C(CC(O)=COC=C(O)CC(c1ccccc1N(C)C)c1ccccc1N(C)C)c1ccccc1N(C)C |
| InChI | InChI=1S/C40H50N4O3/c1-41(2)37-21-13-9-17-31(37)35(32-18-10-14-22-38(32)42(3)4)25-29(45)27-47-28-30(46)26-36(33-19-11-15-23-39(33)43(5)6)34-20-12-16-24-40(34)44(7)8/h9-24,27-28,35-36,45-46H,25-26H2,1-8H3 |
| InChIKey | HCYHUWGQLMAFBB-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 62.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.86 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|