C11H18N2O2 — CID 170828083
3-amino-1-[2-(dimethylamino)phenyl]propane-1,2-diol (PubChem CID 170828083) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 3-amino-1-[2-(dimethylamino)phenyl]propane-1,2-diol.
| Compound Name | 3-amino-1-[2-(dimethylamino)phenyl]propane-1,2-diol |
|---|---|
| PubChem CID | 170828083 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 3-amino-1-[2-(dimethylamino)phenyl]propane-1,2-diol |
| SMILES | CN(C)c1ccccc1C(O)C(O)CN |
| InChI | InChI=1S/C11H18N2O2/c1-13(2)9-6-4-3-5-8(9)11(15)10(14)7-12/h3-6,10-11,14-15H,7,12H2,1-2H3 |
| InChIKey | IPLIYUNWELBIRA-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |